Compound Q&A

What are the physical and chemical properties of (3-Cyanophenoxy)acetic Acid (CAS: 1879-58-9)?

Answer

(3-Cyanophenoxy)acetic Acid
(3-Cyanophenoxy)acetic Acid (CAS: 1879-58-9) is a crystalline solid with a molecular weight of approximately 194.09 g/mol. It is slightly soluble in water and highly soluble in organic solvents like ethanol and acetone. This compound is reactive towards bases and nucleophiles, and it can undergo esterification and substitution reactions.

About

CAS No 1879-58-9
English Name (3-Cyanophenoxy)acetic Acid
Molecular Formula C9H7NO3
Molecular Weight 166.176 g/mol
SMILES C1=CC(=CC(=C1)OCC(=O)O)C#N
InChIKey UXBVJOUILGIGHW-UHFFFAOYSA-N
Last Updated: 2025-11-01 22:12

Related Q&A

Compound Q&A

How is (3-Cyanophenoxy)acetic Acid (CAS: 1879-58-9) typically synthesized?

(3-Cyanophenoxy)acetic Acid (CAS: 1879-58-9) can be synthesized through a series of reactions starti...

Compound Q&A

What industries use (3-Cyanophenoxy)acetic Acid (CAS: 1879-58-9)?

(3-Cyanophenoxy)acetic Acid (CAS: 1879-58-9) is primarily used in the pharmaceutical industry as an ...

Compound Q&A

What precautions should be taken when handling (3-Cyanophenoxy)acetic Acid (CAS: 1879-58-9)?

When handling (3-Cyanophenoxy)acetic Acid (CAS: 1879-58-9), it is crucial to wear appropriate person...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...