Compound Q&A

What industries use N-(2,6-Dimethylphenyl)-N~2~-ethylglycinamide hydrochloride (CAS: 7729-94-4)?

Answer

N-(2,6-Dimethylphenyl)-N~2~-ethylglycinamide hydrochloride (1:1)
N-(2,6-Dimethylphenyl)-N~2~-ethylglycinamide hydrochloride (CAS: 7729-94-4) is used in various industries. It is primarily used in the pharmaceutical industry as an intermediate in the synthesis of certain drugs. It is also used in the polymer industry as a modifier and in the production of sensors and semiconductors for electronic applications.

About

CAS No 7729-94-4
English Name N-(2,6-Dimethylphenyl)-N~2~-ethylglycinamide hydrochloride (1:1)
Molecular Formula C12H19ClN2O
Molecular Weight 242.75 g/mol
SMILES CCNCC(=O)NC1=C(C=CC=C1C)C.Cl
InChIKey KPXFVVHMUVBVGI-UHFFFAOYSA-N
Last Updated: 2025-11-01 22:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of N-(2,6-Dimethylphenyl)-N~2~-ethylglycinamide hydrochloride (CAS: 7729-94-4)?

N-(2,6-Dimethylphenyl)-N~2~-ethylglycinamide hydrochloride (CAS: 7729-94-4) is a white crystalline s...

Compound Q&A

How is N-(2,6-Dimethylphenyl)-N~2~-ethylglycinamide hydrochloride (CAS: 7729-94-4) typically synthesized?

N-(2,6-Dimethylphenyl)-N~2~-ethylglycinamide hydrochloride (CAS: 7729-94-4) is typically synthesized...

Compound Q&A

What precautions should be taken when handling N-(2,6-Dimethylphenyl)-N~2~-ethylglycinamide hydrochloride (CAS: 7729-94-4)?

When handling N-(2,6-Dimethylphenyl)-N~2~-ethylglycinamide hydrochloride (CAS: 7729-94-4), it is imp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...