Compound Q&A

How is N-(2,6-Dimethylphenyl)-N~2~-ethylglycinamide hydrochloride (CAS: 7729-94-4) typically synthesized?

Answer

N-(2,6-Dimethylphenyl)-N~2~-ethylglycinamide hydrochloride (1:1)
N-(2,6-Dimethylphenyl)-N~2~-ethylglycinamide hydrochloride (CAS: 7729-94-4) is typically synthesized via the condensation of 2,6-dimethylbenzylamine with ethyl glycinate in the presence of an acid catalyst, such as hydrochloric acid. The reaction is carried out under standard stirring conditions, and the product is isolated by crystallization from the reaction mixture. The yield is typically around 85-90%.

About

CAS No 7729-94-4
English Name N-(2,6-Dimethylphenyl)-N~2~-ethylglycinamide hydrochloride (1:1)
Molecular Formula C12H19ClN2O
Molecular Weight 242.75 g/mol
SMILES CCNCC(=O)NC1=C(C=CC=C1C)C.Cl
InChIKey KPXFVVHMUVBVGI-UHFFFAOYSA-N
Last Updated: 2025-11-01 22:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of N-(2,6-Dimethylphenyl)-N~2~-ethylglycinamide hydrochloride (CAS: 7729-94-4)?

N-(2,6-Dimethylphenyl)-N~2~-ethylglycinamide hydrochloride (CAS: 7729-94-4) is a white crystalline s...

Compound Q&A

What industries use N-(2,6-Dimethylphenyl)-N~2~-ethylglycinamide hydrochloride (CAS: 7729-94-4)?

N-(2,6-Dimethylphenyl)-N~2~-ethylglycinamide hydrochloride (CAS: 7729-94-4) is used in various indus...

Compound Q&A

What precautions should be taken when handling N-(2,6-Dimethylphenyl)-N~2~-ethylglycinamide hydrochloride (CAS: 7729-94-4)?

When handling N-(2,6-Dimethylphenyl)-N~2~-ethylglycinamide hydrochloride (CAS: 7729-94-4), it is imp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...