Compound Q&A

What precautions should be taken when handling 3,5-Dinitrobenzoyl chloride (CAS: 99-33-2)?

Answer

3,5-Dinitrobenzoyl chloride
When handling 3,5-Dinitrobenzoyl chloride, appropriate personal protective equipment (PPE) should be worn, including gloves, safety goggles, and laboratory coats. Work should be conducted in a well-ventilated area or fume hood to minimize inhalation risks. Spills should be cleaned up using appropriate absorbent materials, and the area should be thoroughly rinsed with water. Refer to the Safety Data Sheet (SDS) for detailed emergency procedures and storage recommendations.

About

CAS No 99-33-2
English Name 3,5-Dinitrobenzoyl chloride
Molecular Formula C7H3ClN2O5
Molecular Weight 230.56 g/mol
SMILES C1=C(C=C(C=C1[N+](=O)[O-])[N+](=O)[O-])C(=O)Cl
InChIKey NNOHXABAQAGKRZ-UHFFFAOYSA-N
Last Updated: 2025-11-01 22:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3,5-Dinitrobenzoyl chloride (CAS: 99-33-2)?

3,5-Dinitrobenzoyl chloride is a crystalline compound with a molecular weight of approximately 244.0...

Compound Q&A

How is 3,5-Dinitrobenzoyl chloride (CAS: 99-33-2) typically synthesized?

3,5-Dinitrobenzoyl chloride is typically synthesized by the reaction of 3,5-dinitrobenzoic acid with...

Compound Q&A

What industries use 3,5-Dinitrobenzoyl chloride (CAS: 99-33-2)?

3,5-Dinitrobenzoyl chloride is used in various industries, including pharmaceuticals, where it serve...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...