Compound Q&A

What are the physical and chemical properties of 3,5-Dinitrobenzoyl chloride (CAS: 99-33-2)?

Answer

3,5-Dinitrobenzoyl chloride
3,5-Dinitrobenzoyl chloride is a crystalline compound with a molecular weight of approximately 244.06 g/mol. It is slightly soluble in water but soluble in organic solvents like ethanol and acetone. Chemically, it is highly reactive, particularly towards nucleophiles and basic compounds. It is an electrophilic aromatic derivative and can undergo substitution and addition reactions.

About

CAS No 99-33-2
English Name 3,5-Dinitrobenzoyl chloride
Molecular Formula C7H3ClN2O5
Molecular Weight 230.56 g/mol
SMILES C1=C(C=C(C=C1[N+](=O)[O-])[N+](=O)[O-])C(=O)Cl
InChIKey NNOHXABAQAGKRZ-UHFFFAOYSA-N
Last Updated: 2025-11-01 22:12

Related Q&A

Compound Q&A

How is 3,5-Dinitrobenzoyl chloride (CAS: 99-33-2) typically synthesized?

3,5-Dinitrobenzoyl chloride is typically synthesized by the reaction of 3,5-dinitrobenzoic acid with...

Compound Q&A

What industries use 3,5-Dinitrobenzoyl chloride (CAS: 99-33-2)?

3,5-Dinitrobenzoyl chloride is used in various industries, including pharmaceuticals, where it serve...

Compound Q&A

What precautions should be taken when handling 3,5-Dinitrobenzoyl chloride (CAS: 99-33-2)?

When handling 3,5-Dinitrobenzoyl chloride, appropriate personal protective equipment (PPE) should be...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...