Compound Q&A

How is 3,5-Dinitrobenzoyl chloride (CAS: 99-33-2) typically synthesized?

Answer

3,5-Dinitrobenzoyl chloride
3,5-Dinitrobenzoyl chloride is typically synthesized by the reaction of 3,5-dinitrobenzoic acid with thionyl chloride. The process involves heating the mixture to remove water and form the chloride derivative. This synthesis is selective and yields a high percentage of the desired product under mild conditions.

About

CAS No 99-33-2
English Name 3,5-Dinitrobenzoyl chloride
Molecular Formula C7H3ClN2O5
Molecular Weight 230.56 g/mol
SMILES C1=C(C=C(C=C1[N+](=O)[O-])[N+](=O)[O-])C(=O)Cl
InChIKey NNOHXABAQAGKRZ-UHFFFAOYSA-N
Last Updated: 2025-11-01 22:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3,5-Dinitrobenzoyl chloride (CAS: 99-33-2)?

3,5-Dinitrobenzoyl chloride is a crystalline compound with a molecular weight of approximately 244.0...

Compound Q&A

What industries use 3,5-Dinitrobenzoyl chloride (CAS: 99-33-2)?

3,5-Dinitrobenzoyl chloride is used in various industries, including pharmaceuticals, where it serve...

Compound Q&A

What precautions should be taken when handling 3,5-Dinitrobenzoyl chloride (CAS: 99-33-2)?

When handling 3,5-Dinitrobenzoyl chloride, appropriate personal protective equipment (PPE) should be...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...