Compound Q&A

What precautions should be taken when handling Diethyldithiocarbamic acid copper salt (CAS: 13681-87-3)?

Answer

Diethyldithiocarbamic acid copper salt
When handling Diethyldithiocarbamic acid copper salt, wear protective gloves and safety goggles. Store it in a well-ventilated area away from heat sources. Use a fume hood during preparation and use appropriate personal protective equipment (PPE). In case of spill, neutralize the spill with an appropriate agent and follow the safety data sheet (SDS) for disposal instructions.

About

CAS No 13681-87-3
English Name Diethyldithiocarbamic acid copper salt
Molecular Formula C10H20CuN2S4
Molecular Weight 360.1 g/mol
SMILES CCN(CC)C(=S)[S-].CCN(CC)C(=S)[S-].[Cu+2]
InChIKey OBBCYCYCTJQCCK-UHFFFAOYSA-L
Last Updated: 2025-11-01 22:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of Diethyldithiocarbamic acid copper salt (CAS: 13681-87-3)?

Diethyldithiocarbamic acid copper salt is a crystalline solid with a molecular weight of approximate...

Compound Q&A

How is Diethyldithiocarbamic acid copper salt (CAS: 13681-87-3) typically synthesized?

Diethyldithiocarbamic acid copper salt can be synthesized by reacting copper sulfate with sodium eth...

Compound Q&A

What industries use Diethyldithiocarbamic acid copper salt (CAS: 13681-87-3)?

Diethyldithiocarbamic acid copper salt is used in the semiconductor industry for etching processes a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...