Compound Q&A

What industries use Diethyldithiocarbamic acid copper salt (CAS: 13681-87-3)?

Answer

Diethyldithiocarbamic acid copper salt
Diethyldithiocarbamic acid copper salt is used in the semiconductor industry for etching processes and as a catalyst in organic synthesis. It also finds applications in the pharmaceutical industry as a precursor for other copper compounds and in the polymer industry for stabilizing polymer properties.

About

CAS No 13681-87-3
English Name Diethyldithiocarbamic acid copper salt
Molecular Formula C10H20CuN2S4
Molecular Weight 360.1 g/mol
SMILES CCN(CC)C(=S)[S-].CCN(CC)C(=S)[S-].[Cu+2]
InChIKey OBBCYCYCTJQCCK-UHFFFAOYSA-L
Last Updated: 2025-11-01 22:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of Diethyldithiocarbamic acid copper salt (CAS: 13681-87-3)?

Diethyldithiocarbamic acid copper salt is a crystalline solid with a molecular weight of approximate...

Compound Q&A

How is Diethyldithiocarbamic acid copper salt (CAS: 13681-87-3) typically synthesized?

Diethyldithiocarbamic acid copper salt can be synthesized by reacting copper sulfate with sodium eth...

Compound Q&A

What precautions should be taken when handling Diethyldithiocarbamic acid copper salt (CAS: 13681-87-3)?

When handling Diethyldithiocarbamic acid copper salt, wear protective gloves and safety goggles. Sto...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...