Compound Q&A

How is Diethyldithiocarbamic acid copper salt (CAS: 13681-87-3) typically synthesized?

Answer

Diethyldithiocarbamic acid copper salt
Diethyldithiocarbamic acid copper salt can be synthesized by reacting copper sulfate with sodium ethyldithiocarbamate in an aqueous solution. The reaction is carried out at room temperature, and the product is isolated by filtration. Commonly, the salt forms a crystalline precipitate that can be dried and purified.

About

CAS No 13681-87-3
English Name Diethyldithiocarbamic acid copper salt
Molecular Formula C10H20CuN2S4
Molecular Weight 360.1 g/mol
SMILES CCN(CC)C(=S)[S-].CCN(CC)C(=S)[S-].[Cu+2]
InChIKey OBBCYCYCTJQCCK-UHFFFAOYSA-L
Last Updated: 2025-11-01 22:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of Diethyldithiocarbamic acid copper salt (CAS: 13681-87-3)?

Diethyldithiocarbamic acid copper salt is a crystalline solid with a molecular weight of approximate...

Compound Q&A

What industries use Diethyldithiocarbamic acid copper salt (CAS: 13681-87-3)?

Diethyldithiocarbamic acid copper salt is used in the semiconductor industry for etching processes a...

Compound Q&A

What precautions should be taken when handling Diethyldithiocarbamic acid copper salt (CAS: 13681-87-3)?

When handling Diethyldithiocarbamic acid copper salt, wear protective gloves and safety goggles. Sto...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...