Compound Q&A

What precautions should be taken when handling Guanylmelamine (CAS: 4405-08-7)?

Answer

Guanylmelamine
When handling Guanylmelamine (CAS: 4405-08-7), it is essential to use personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or under a fume hood to minimize inhalation risks. Spills should be cleaned up with appropriate solvents, and proper disposal methods should be followed. Always refer to the safety data sheet (SDS) for detailed handling and emergency procedures.

About

CAS No 4405-08-7
English Name Guanylmelamine
Molecular Formula C4H8N8
Molecular Weight 168.16 g/mol
SMILES C1(=NC(=NC(=N1)N=C(N)N)N)N
InChIKey QLVPICNVQBBOQP-UHFFFAOYSA-N
Last Updated: 2025-11-01 22:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of Guanylmelamine (CAS: 4405-08-7)?

Guanylmelamine (CAS: 4405-08-7) is a white crystalline powder with a molecular weight of approximate...

Compound Q&A

How is Guanylmelamine (CAS: 4405-08-7) typically synthesized?

Guanylmelamine (CAS: 4405-08-7) is synthesized by the reaction of guanidine with melamine. Commonly,...

Compound Q&A

What industries use Guanylmelamine (CAS: 4405-08-7)?

Guanylmelamine (CAS: 4405-08-7) is primarily used in the pharmaceutical industry for the synthesis o...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...