Compound Q&A

What industries use Guanylmelamine (CAS: 4405-08-7)?

Answer

Guanylmelamine
Guanylmelamine (CAS: 4405-08-7) is primarily used in the pharmaceutical industry for the synthesis of certain drugs and intermediates. It also finds applications in the polymer industry as a stabilizer and in the production of certain additives. Additionally, it is used in the sensor industry for gas detection and in semiconductor technology for specific applications requiring its unique physical and chemical properties.

About

CAS No 4405-08-7
English Name Guanylmelamine
Molecular Formula C4H8N8
Molecular Weight 168.16 g/mol
SMILES C1(=NC(=NC(=N1)N=C(N)N)N)N
InChIKey QLVPICNVQBBOQP-UHFFFAOYSA-N
Last Updated: 2025-11-01 22:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of Guanylmelamine (CAS: 4405-08-7)?

Guanylmelamine (CAS: 4405-08-7) is a white crystalline powder with a molecular weight of approximate...

Compound Q&A

How is Guanylmelamine (CAS: 4405-08-7) typically synthesized?

Guanylmelamine (CAS: 4405-08-7) is synthesized by the reaction of guanidine with melamine. Commonly,...

Compound Q&A

What precautions should be taken when handling Guanylmelamine (CAS: 4405-08-7)?

When handling Guanylmelamine (CAS: 4405-08-7), it is essential to use personal protective equipment ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...