Compound Q&A

How is Guanylmelamine (CAS: 4405-08-7) typically synthesized?

Answer

Guanylmelamine
Guanylmelamine (CAS: 4405-08-7) is synthesized by the reaction of guanidine with melamine. Commonly, this is achieved by the condensation of guanidine with melamine in the presence of a suitable catalyst such as sodium hydroxide. The reaction typically yields a mixture of isomers, with the desired product being isolated through crystallization. The yield is generally around 70-80%, depending on the purity of the reactants and the efficiency of the purification steps.

About

CAS No 4405-08-7
English Name Guanylmelamine
Molecular Formula C4H8N8
Molecular Weight 168.16 g/mol
SMILES C1(=NC(=NC(=N1)N=C(N)N)N)N
InChIKey QLVPICNVQBBOQP-UHFFFAOYSA-N
Last Updated: 2025-11-01 22:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of Guanylmelamine (CAS: 4405-08-7)?

Guanylmelamine (CAS: 4405-08-7) is a white crystalline powder with a molecular weight of approximate...

Compound Q&A

What industries use Guanylmelamine (CAS: 4405-08-7)?

Guanylmelamine (CAS: 4405-08-7) is primarily used in the pharmaceutical industry for the synthesis o...

Compound Q&A

What precautions should be taken when handling Guanylmelamine (CAS: 4405-08-7)?

When handling Guanylmelamine (CAS: 4405-08-7), it is essential to use personal protective equipment ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...