Compound Q&A

What precautions should be taken when handling 1-Methyl-3-propylimidazolium hexafluorophosphate (CAS: 216300-12-8)?

Answer

1-Methyl-3-propylimidazolium hexafluorophosphate
When handling 1-Methyl-3-propylimidazolium hexafluorophosphate (CAS: 216300-12-8), it is essential to wear appropriate personal protective equipment (PPE) including gloves, goggles, and a lab coat. Store it in a fume hood to avoid exposure to moisture and heat. In case of a spill, ensure proper ventilation and dispose of the material according to safety data sheet (SDS) guidelines. Follow all recommended safety protocols to prevent accidents and ensure laboratory safety.

About

English Name 1-Methyl-3-propylimidazolium hexafluorophosphate
Molecular Formula C7H13F6N2P
Molecular Weight 270.16 g/mol
SMILES CCCN1C=C[N+](=C1)C.F[P-](F)(F)(F)(F)F
InChIKey WSQGDTFNZPZTHQ-UHFFFAOYSA-O
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Methyl-3-propylimidazolium hexafluorophosphate (CAS: 216300-12-8)?

1-Methyl-3-propylimidazolium hexafluorophosphate (CAS: 216300-12-8) is a crystalline compound with a...

Compound Q&A

How is 1-Methyl-3-propylimidazolium hexafluorophosphate (CAS: 216300-12-8) typically synthesized?

1-Methyl-3-propylimidazolium hexafluorophosphate is typically synthesized by reacting 1-methyl-3-pro...

Compound Q&A

What industries use 1-Methyl-3-propylimidazolium hexafluorophosphate (CAS: 216300-12-8)?

1-Methyl-3-propylimidazolium hexafluorophosphate (CAS: 216300-12-8) is widely used in the field of e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...