Compound Q&A

How is 1-Methyl-3-propylimidazolium hexafluorophosphate (CAS: 216300-12-8) typically synthesized?

Answer

1-Methyl-3-propylimidazolium hexafluorophosphate
1-Methyl-3-propylimidazolium hexafluorophosphate is typically synthesized by reacting 1-methyl-3-propylimidazolium bis(trifluoromethanesulfonyl)imide (TFSI) with hexafluorophosphate (PF6) in an aprotic solvent like acetonitrile. The reaction is conducted under anhydrous conditions to avoid hydrolysis. Yields are generally high, with selectivity towards the hexafluorophosphate salt.

About

English Name 1-Methyl-3-propylimidazolium hexafluorophosphate
Molecular Formula C7H13F6N2P
Molecular Weight 270.16 g/mol
SMILES CCCN1C=C[N+](=C1)C.F[P-](F)(F)(F)(F)F
InChIKey WSQGDTFNZPZTHQ-UHFFFAOYSA-O
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Methyl-3-propylimidazolium hexafluorophosphate (CAS: 216300-12-8)?

1-Methyl-3-propylimidazolium hexafluorophosphate (CAS: 216300-12-8) is a crystalline compound with a...

Compound Q&A

What industries use 1-Methyl-3-propylimidazolium hexafluorophosphate (CAS: 216300-12-8)?

1-Methyl-3-propylimidazolium hexafluorophosphate (CAS: 216300-12-8) is widely used in the field of e...

Compound Q&A

What precautions should be taken when handling 1-Methyl-3-propylimidazolium hexafluorophosphate (CAS: 216300-12-8)?

When handling 1-Methyl-3-propylimidazolium hexafluorophosphate (CAS: 216300-12-8), it is essential t...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...