Compound Q&A

What are the physical and chemical properties of 1-Methyl-3-propylimidazolium hexafluorophosphate (CAS: 216300-12-8)?

Answer

1-Methyl-3-propylimidazolium hexafluorophosphate
1-Methyl-3-propylimidazolium hexafluorophosphate (CAS: 216300-12-8) is a crystalline compound with a molecular weight of approximately 249.07 g/mol. It is soluble in organic solvents like acetonitrile and dimethyl sulfoxide. Chemically, it shows moderate reactivity with strong acids and bases. It is stable under normal conditions but sensitive to moisture and heat.

About

English Name 1-Methyl-3-propylimidazolium hexafluorophosphate
Molecular Formula C7H13F6N2P
Molecular Weight 270.16 g/mol
SMILES CCCN1C=C[N+](=C1)C.F[P-](F)(F)(F)(F)F
InChIKey WSQGDTFNZPZTHQ-UHFFFAOYSA-O
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

How is 1-Methyl-3-propylimidazolium hexafluorophosphate (CAS: 216300-12-8) typically synthesized?

1-Methyl-3-propylimidazolium hexafluorophosphate is typically synthesized by reacting 1-methyl-3-pro...

Compound Q&A

What industries use 1-Methyl-3-propylimidazolium hexafluorophosphate (CAS: 216300-12-8)?

1-Methyl-3-propylimidazolium hexafluorophosphate (CAS: 216300-12-8) is widely used in the field of e...

Compound Q&A

What precautions should be taken when handling 1-Methyl-3-propylimidazolium hexafluorophosphate (CAS: 216300-12-8)?

When handling 1-Methyl-3-propylimidazolium hexafluorophosphate (CAS: 216300-12-8), it is essential t...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...