Compound Q&A

What precautions should be taken when handling 2-(2-Carboxyethyl)benzoic acid (CAS: 776-79-4)?

Answer

2-(2-Carboxyethyl)benzoic acid
When handling 2-(2-Carboxyethyl)benzoic acid (CAS: 776-79-4), it is important to use appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. The compound should be handled in a well-ventilated area or fume hood due to its volatility. Spills should be handled with appropriate absorbents, and the material safety data sheet (MSDS) should always be consulted for specific safety guidelines.

About

CAS No 776-79-4
English Name 2-(2-Carboxyethyl)benzoic acid
Molecular Formula C10H10O4
Molecular Weight 194.19 g/mol
SMILES C1=CC=C(C(=C1)CCC(=O)O)C(=O)O
InChIKey VEEXBQLWMFMATJ-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(2-Carboxyethyl)benzoic acid (CAS: 776-79-4)?

2-(2-Carboxyethyl)benzoic acid (CAS: 776-79-4) is a white or off-white crystalline solid. Its molecu...

Compound Q&A

How is 2-(2-Carboxyethyl)benzoic acid (CAS: 776-79-4) typically synthesized?

2-(2-Carboxyethyl)benzoic acid is typically synthesized through the reaction of 2-aminophenol with a...

Compound Q&A

What industries use 2-(2-Carboxyethyl)benzoic acid (CAS: 776-79-4)?

2-(2-Carboxyethyl)benzoic acid (CAS: 776-79-4) is used in various industries, including pharmaceutic...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...