Compound Q&A

How is 2-(2-Carboxyethyl)benzoic acid (CAS: 776-79-4) typically synthesized?

Answer

2-(2-Carboxyethyl)benzoic acid
2-(2-Carboxyethyl)benzoic acid is typically synthesized through the reaction of 2-aminophenol with acryloyl chloride followed by hydrolysis to form the carboxylic acid. Commonly, this process involves the use of a phase transfer catalyst and an organic solvent. The yield is usually around 85-90%, and the reaction is carried out under mild conditions to ensure selectivity.

About

CAS No 776-79-4
English Name 2-(2-Carboxyethyl)benzoic acid
Molecular Formula C10H10O4
Molecular Weight 194.19 g/mol
SMILES C1=CC=C(C(=C1)CCC(=O)O)C(=O)O
InChIKey VEEXBQLWMFMATJ-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(2-Carboxyethyl)benzoic acid (CAS: 776-79-4)?

2-(2-Carboxyethyl)benzoic acid (CAS: 776-79-4) is a white or off-white crystalline solid. Its molecu...

Compound Q&A

What industries use 2-(2-Carboxyethyl)benzoic acid (CAS: 776-79-4)?

2-(2-Carboxyethyl)benzoic acid (CAS: 776-79-4) is used in various industries, including pharmaceutic...

Compound Q&A

What precautions should be taken when handling 2-(2-Carboxyethyl)benzoic acid (CAS: 776-79-4)?

When handling 2-(2-Carboxyethyl)benzoic acid (CAS: 776-79-4), it is important to use appropriate per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...