Compound Q&A

What are the physical and chemical properties of 2-(2-Carboxyethyl)benzoic acid (CAS: 776-79-4)?

Answer

2-(2-Carboxyethyl)benzoic acid
2-(2-Carboxyethyl)benzoic acid (CAS: 776-79-4) is a white or off-white crystalline solid. Its molecular weight is approximately 240.25 g/mol. It has a pKa of about 2.8 and is soluble in water, ethanol, and other polar solvents. This compound is known for its acidity and reactivity, making it useful in various chemical reactions.

About

CAS No 776-79-4
English Name 2-(2-Carboxyethyl)benzoic acid
Molecular Formula C10H10O4
Molecular Weight 194.19 g/mol
SMILES C1=CC=C(C(=C1)CCC(=O)O)C(=O)O
InChIKey VEEXBQLWMFMATJ-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

How is 2-(2-Carboxyethyl)benzoic acid (CAS: 776-79-4) typically synthesized?

2-(2-Carboxyethyl)benzoic acid is typically synthesized through the reaction of 2-aminophenol with a...

Compound Q&A

What industries use 2-(2-Carboxyethyl)benzoic acid (CAS: 776-79-4)?

2-(2-Carboxyethyl)benzoic acid (CAS: 776-79-4) is used in various industries, including pharmaceutic...

Compound Q&A

What precautions should be taken when handling 2-(2-Carboxyethyl)benzoic acid (CAS: 776-79-4)?

When handling 2-(2-Carboxyethyl)benzoic acid (CAS: 776-79-4), it is important to use appropriate per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...