Compound Q&A

What industries use Methyl 2,3-dichloroquinoxaline-6-carboxylate (CAS: 108258-54-4)?

Answer

Methyl 2,3-dichloroquinoxaline-6-carboxylate
Methyl 2,3-dichloroquinoxaline-6-carboxylate finds applications in the pharmaceutical industry for the synthesis of certain drug intermediates. It is also utilized in the polymer industry for the development of specific polymers with unique properties. Additionally, this compound can be used in the electronics and semiconductor sectors for creating sensitive sensors and other electronic components.

About

English Name Methyl 2,3-dichloroquinoxaline-6-carboxylate
Molecular Formula C10H6Cl2N2O2
Molecular Weight 257.08 g/mol
SMILES COC(=O)C1=CC2=C(C=C1)N=C(C(=N2)Cl)Cl
InChIKey ZLWYANCDEVPWLW-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 2,3-dichloroquinoxaline-6-carboxylate (CAS: 108258-54-4)?

Methyl 2,3-dichloroquinoxaline-6-carboxylate is a solid with a crystalline form. Its molecular weigh...

Compound Q&A

How is Methyl 2,3-dichloroquinoxaline-6-carboxylate (CAS: 108258-54-4) typically synthesized?

Methyl 2,3-dichloroquinoxaline-6-carboxylate can be synthesized via the condensation of 2,3-dichloro...

Compound Q&A

What precautions should be taken when handling Methyl 2,3-dichloroquinoxaline-6-carboxylate (CAS: 108258-54-4)?

When handling Methyl 2,3-dichloroquinoxaline-6-carboxylate, it is essential to wear appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...