Compound Q&A

How is Methyl 2,3-dichloroquinoxaline-6-carboxylate (CAS: 108258-54-4) typically synthesized?

Answer

Methyl 2,3-dichloroquinoxaline-6-carboxylate
Methyl 2,3-dichloroquinoxaline-6-carboxylate can be synthesized via the condensation of 2,3-dichloroquinoxaline with methyl acetoacetate in the presence of a suitable catalyst such as p-toluenesulfonic acid. The reaction yields a mixture of diastereomers, but the desired product can be isolated through recrystallization. The yield is typically around 70-80%.

About

English Name Methyl 2,3-dichloroquinoxaline-6-carboxylate
Molecular Formula C10H6Cl2N2O2
Molecular Weight 257.08 g/mol
SMILES COC(=O)C1=CC2=C(C=C1)N=C(C(=N2)Cl)Cl
InChIKey ZLWYANCDEVPWLW-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 2,3-dichloroquinoxaline-6-carboxylate (CAS: 108258-54-4)?

Methyl 2,3-dichloroquinoxaline-6-carboxylate is a solid with a crystalline form. Its molecular weigh...

Compound Q&A

What industries use Methyl 2,3-dichloroquinoxaline-6-carboxylate (CAS: 108258-54-4)?

Methyl 2,3-dichloroquinoxaline-6-carboxylate finds applications in the pharmaceutical industry for t...

Compound Q&A

What precautions should be taken when handling Methyl 2,3-dichloroquinoxaline-6-carboxylate (CAS: 108258-54-4)?

When handling Methyl 2,3-dichloroquinoxaline-6-carboxylate, it is essential to wear appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...