Compound Q&A

How is Methyl 2,3-dichloroquinoxaline-6-carboxylate (CAS: 108258-54-4) typically synthesized?

Answer

Methyl 2,3-dichloroquinoxaline-6-carboxylate
Methyl 2,3-dichloroquinoxaline-6-carboxylate can be synthesized via the condensation of 2,3-dichloroquinoxaline with methyl acetoacetate in the presence of a suitable catalyst such as p-toluenesulfonic acid. The reaction yields a mixture of diastereomers, but the desired product can be isolated through recrystallization. The yield is typically around 70-80%.

About

English Name Methyl 2,3-dichloroquinoxaline-6-carboxylate
Molecular Formula C10H6Cl2N2O2
Molecular Weight 257.076 g/mol
SMILES COC(=O)C1=CC2=C(C=C1)N=C(C(=N2)Cl)Cl
InChIKey ZLWYANCDEVPWLW-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 2,3-dichloroquinoxaline-6-carboxylate (CAS: 108258-54-4)?

Methyl 2,3-dichloroquinoxaline-6-carboxylate is a solid with a crystalline form. Its molecular weigh...

Compound Q&A

What industries use Methyl 2,3-dichloroquinoxaline-6-carboxylate (CAS: 108258-54-4)?

Methyl 2,3-dichloroquinoxaline-6-carboxylate finds applications in the pharmaceutical industry for t...

Compound Q&A

What precautions should be taken when handling Methyl 2,3-dichloroquinoxaline-6-carboxylate (CAS: 108258-54-4)?

When handling Methyl 2,3-dichloroquinoxaline-6-carboxylate, it is essential to wear appropriate pers...

Compound Q&A

Is 6-(3-Fluorophenyl)picolinic acid (CAS: 887982-40-3) safe?

6-(3-Fluorophenyl)picolinic acid is generally considered safe for laboratory use...

887982-40-36-(3-Fluorophenyl)pi...
Compound Q&A

What industries use (3R)-3-Pyrrolidinol (CAS: 2799-21-5)?

(3R)-3-Pyrrolidinol is used in the pharmaceutical industry as a precursor for dr...

2799-21-5(3R)-3-Pyrrolidinol
Compound Q&A

What precautions should be taken when handling (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-8)?

When handling (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-...

59779-75-8(4R,5R)-4,5-Diethoxy...
Compound Q&A

How is 1-(6-Chloroimidazo[1,2-b]pyridazin-3-yl)ethanone (CAS: 90734-71-7) typically synthesized?

1-(6-Chloroimidazo[1,2-b]pyridazin-3-yl)ethanone is often synthesized via a mult...

90734-71-71-(6-Chloroimidazo[1...