Compound Q&A

What are the physical and chemical properties of Methyl 2,3-dichloroquinoxaline-6-carboxylate (CAS: 108258-54-4)?

Answer

Methyl 2,3-dichloroquinoxaline-6-carboxylate
Methyl 2,3-dichloroquinoxaline-6-carboxylate is a solid with a crystalline form. Its molecular weight is approximately 303.03 g/mol. The compound is slightly soluble in water but soluble in organic solvents like DMSO and DMF. It is moderately reactive with basic or reducing agents. The compound exhibits good thermal stability but may decompose at higher temperatures.

About

English Name Methyl 2,3-dichloroquinoxaline-6-carboxylate
Molecular Formula C10H6Cl2N2O2
Molecular Weight 257.076 g/mol
SMILES COC(=O)C1=CC2=C(C=C1)N=C(C(=N2)Cl)Cl
InChIKey ZLWYANCDEVPWLW-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

How is Methyl 2,3-dichloroquinoxaline-6-carboxylate (CAS: 108258-54-4) typically synthesized?

Methyl 2,3-dichloroquinoxaline-6-carboxylate can be synthesized via the condensation of 2,3-dichloro...

Compound Q&A

What industries use Methyl 2,3-dichloroquinoxaline-6-carboxylate (CAS: 108258-54-4)?

Methyl 2,3-dichloroquinoxaline-6-carboxylate finds applications in the pharmaceutical industry for t...

Compound Q&A

What precautions should be taken when handling Methyl 2,3-dichloroquinoxaline-6-carboxylate (CAS: 108258-54-4)?

When handling Methyl 2,3-dichloroquinoxaline-6-carboxylate, it is essential to wear appropriate pers...

Compound Q&A

Is 6-(3-Fluorophenyl)picolinic acid (CAS: 887982-40-3) safe?

6-(3-Fluorophenyl)picolinic acid is generally considered safe for laboratory use...

887982-40-36-(3-Fluorophenyl)pi...
Compound Q&A

What industries use (3R)-3-Pyrrolidinol (CAS: 2799-21-5)?

(3R)-3-Pyrrolidinol is used in the pharmaceutical industry as a precursor for dr...

2799-21-5(3R)-3-Pyrrolidinol
Compound Q&A

What precautions should be taken when handling (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-8)?

When handling (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-...

59779-75-8(4R,5R)-4,5-Diethoxy...
Compound Q&A

How is 1-(6-Chloroimidazo[1,2-b]pyridazin-3-yl)ethanone (CAS: 90734-71-7) typically synthesized?

1-(6-Chloroimidazo[1,2-b]pyridazin-3-yl)ethanone is often synthesized via a mult...

90734-71-71-(6-Chloroimidazo[1...