Compound Q&A

What industries use Selamectin (CAS: 165108-07-6)?

Answer

Selamectin
Selamectin is primarily used in the pharmaceutical industry for its use as a deworming and antiparasitic agent in veterinary medicine. It is also used in the agricultural industry for pest control. Additionally, it has potential applications in the medical field for treating parasitic infections in humans. While not extensively studied, there is interest in using Selamectin in sensor development due to its unique chemical properties.

About

English Name Selamectin
Molecular Formula C43H63NO11
Molecular Weight 770 g/mol
SMILES CC1CCC2(CC3CC(O2)CC=C(C(C(C=CC=C4COC5C4(C(C=C(C5=NO)C)C(=O)O3)O)C)OC6CC(C(C(O6)C)O)OC)C)OC1C7CCCCC7
InChIKey AFJYYKSVHJGXSN-XHKIUTQPSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of Selamectin (CAS: 165108-07-6)?

Selamectin is a white to slightly off-white crystalline粉末. Its molecular weight is approximately 426...

Compound Q&A

How is Selamectin (CAS: 165108-07-6) typically synthesized?

Selamectin is typically synthesized through a multistep organic synthesis process involving several ...

Compound Q&A

What precautions should be taken when handling Selamectin (CAS: 165108-07-6)?

When handling Selamectin, it is important to use proper personal protective equipment (PPE) such as ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...