Compound Q&A

How is Selamectin (CAS: 165108-07-6) typically synthesized?

Answer

Selamectin
Selamectin is typically synthesized through a multistep organic synthesis process involving several key reactions such as alkylation, cyclization, and oxidation. The synthesis employs common organic solvents and requires the use of protecting groups. The overall yield is moderate, and the process involves the use of catalysts and reagents like sodium hydride, dichloromethane, and tert-butanol. The final product is obtained through recrystallization and purification steps.

About

English Name Selamectin
Molecular Formula C43H63NO11
Molecular Weight 770 g/mol
SMILES CC1CCC2(CC3CC(O2)CC=C(C(C(C=CC=C4COC5C4(C(C=C(C5=NO)C)C(=O)O3)O)C)OC6CC(C(C(O6)C)O)OC)C)OC1C7CCCCC7
InChIKey AFJYYKSVHJGXSN-XHKIUTQPSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of Selamectin (CAS: 165108-07-6)?

Selamectin is a white to slightly off-white crystalline粉末. Its molecular weight is approximately 426...

Compound Q&A

What industries use Selamectin (CAS: 165108-07-6)?

Selamectin is primarily used in the pharmaceutical industry for its use as a deworming and antiparas...

Compound Q&A

What precautions should be taken when handling Selamectin (CAS: 165108-07-6)?

When handling Selamectin, it is important to use proper personal protective equipment (PPE) such as ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...