Compound Q&A

What are the physical and chemical properties of 2,4,6-Trichloronicotinaldehyde (CAS: 1261269-66-2)?

Answer

2,4,6-Trichloronicotinaldehyde
2,4,6-Trichloronicotinaldehyde is a white crystalline solid with a molecular weight of approximately 217.07 g/mol. It has low water solubility and is moderately soluble in organic solvents. This compound is known for its reactivity with nucleophiles and can undergo substitution reactions. It is stable under normal conditions but should be stored in a cool, dry place away from moisture and reducing agents.

About

English Name 2,4,6-Trichloronicotinaldehyde
Molecular Formula C6H2Cl3NO
Molecular Weight 210.45 g/mol
SMILES C1=C(C(=C(N=C1Cl)Cl)C=O)Cl
InChIKey RESMQRUOHBZJCA-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

How is 2,4,6-Trichloronicotinaldehyde (CAS: 1261269-66-2) typically synthesized?

2,4,6-Trichloronicotinaldehyde is typically synthesized by chlorinating nicotinaldehyde using thiony...

Compound Q&A

What industries use 2,4,6-Trichloronicotinaldehyde (CAS: 1261269-66-2)?

2,4,6-Trichloronicotinaldehyde is used in the pharmaceutical industry for the synthesis of various i...

Compound Q&A

What precautions should be taken when handling 2,4,6-Trichloronicotinaldehyde (CAS: 1261269-66-2)?

Proper personal protective equipment (PPE) such as gloves, goggles, and a laboratory coat should be ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...