Compound Q&A

What precautions should be taken when handling 1,3-Bis(2-isocyanato-2-propanyl)benzene (CAS: 2778-42-9)?

Answer

1,3-Bis(2-isocyanato-2-propanyl)benzene
When handling 1,3-Bis(2-isocyanato-2-propanyl)benzene (CAS: 2778-42-9), it is essential to wear personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Ensure the use of a fume hood during preparation. Spills should be contained and cleaned up using appropriate absorbent materials. Refer to the safety data sheet (SDS) for detailed safety information and emergency procedures.

About

CAS No 2778-42-9
English Name 1,3-Bis(2-isocyanato-2-propanyl)benzene
Molecular Formula C14H16N2O2
Molecular Weight 244.29 g/mol
SMILES CC(C)(N=C=O)c1cccc(c1)C(C)(C)N=C=O
InChIKey AZYRZNIYJDKRHO-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,3-Bis(2-isocyanato-2-propanyl)benzene (CAS: 2778-42-9)?

1,3-Bis(2-isocyanato-2-propanyl)benzene (CAS: 2778-42-9) is a solid crystalline compound with a mole...

Compound Q&A

How is 1,3-Bis(2-isocyanato-2-propanyl)benzene (CAS: 2778-42-9) typically synthesized?

1,3-Bis(2-isocyanato-2-propanyl)benzene is typically synthesized via the reaction of 1,3-bis(bromome...

Compound Q&A

What industries use 1,3-Bis(2-isocyanato-2-propanyl)benzene (CAS: 2778-42-9)?

1,3-Bis(2-isocyanato-2-propanyl)benzene (CAS: 2778-42-9) is used in various industries, including ph...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...