Compound Q&A

How is 1,3-Bis(2-isocyanato-2-propanyl)benzene (CAS: 2778-42-9) typically synthesized?

Answer

1,3-Bis(2-isocyanato-2-propanyl)benzene
1,3-Bis(2-isocyanato-2-propanyl)benzene is typically synthesized via the reaction of 1,3-bis(bromomethyl)benzene with phosgene in the presence of a catalyst, such as anhydrous zinc chloride. The reaction provides high selectivity and yields up to 90% of the desired product.

About

CAS No 2778-42-9
English Name 1,3-Bis(2-isocyanato-2-propanyl)benzene
Molecular Formula C14H16N2O2
Molecular Weight 244.29 g/mol
SMILES CC(C)(N=C=O)c1cccc(c1)C(C)(C)N=C=O
InChIKey AZYRZNIYJDKRHO-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,3-Bis(2-isocyanato-2-propanyl)benzene (CAS: 2778-42-9)?

1,3-Bis(2-isocyanato-2-propanyl)benzene (CAS: 2778-42-9) is a solid crystalline compound with a mole...

Compound Q&A

What industries use 1,3-Bis(2-isocyanato-2-propanyl)benzene (CAS: 2778-42-9)?

1,3-Bis(2-isocyanato-2-propanyl)benzene (CAS: 2778-42-9) is used in various industries, including ph...

Compound Q&A

What precautions should be taken when handling 1,3-Bis(2-isocyanato-2-propanyl)benzene (CAS: 2778-42-9)?

When handling 1,3-Bis(2-isocyanato-2-propanyl)benzene (CAS: 2778-42-9), it is essential to wear pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...