Compound Q&A

What are the physical and chemical properties of 1,3-Bis(2-isocyanato-2-propanyl)benzene (CAS: 2778-42-9)?

Answer

1,3-Bis(2-isocyanato-2-propanyl)benzene
1,3-Bis(2-isocyanato-2-propanyl)benzene (CAS: 2778-42-9) is a solid crystalline compound with a molecular weight of approximately 276.27 g/mol. It is poorly soluble in water but soluble in organic solvents such as dichloromethane and acetone. The compound exhibits strong reactivity, particularly towards nucleophiles and hydrolysis under basic conditions.

About

CAS No 2778-42-9
English Name 1,3-Bis(2-isocyanato-2-propanyl)benzene
Molecular Formula C14H16N2O2
Molecular Weight 244.29 g/mol
SMILES CC(C)(N=C=O)c1cccc(c1)C(C)(C)N=C=O
InChIKey AZYRZNIYJDKRHO-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

How is 1,3-Bis(2-isocyanato-2-propanyl)benzene (CAS: 2778-42-9) typically synthesized?

1,3-Bis(2-isocyanato-2-propanyl)benzene is typically synthesized via the reaction of 1,3-bis(bromome...

Compound Q&A

What industries use 1,3-Bis(2-isocyanato-2-propanyl)benzene (CAS: 2778-42-9)?

1,3-Bis(2-isocyanato-2-propanyl)benzene (CAS: 2778-42-9) is used in various industries, including ph...

Compound Q&A

What precautions should be taken when handling 1,3-Bis(2-isocyanato-2-propanyl)benzene (CAS: 2778-42-9)?

When handling 1,3-Bis(2-isocyanato-2-propanyl)benzene (CAS: 2778-42-9), it is essential to wear pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...