Compound Q&A

What industries use 4-[3,5-bis(4-carboxyphenyl)-2,4,6-trimethyl-phenyl]benzoic acid (CAS: 1246562-60-6)?

Answer

4-[3,5-bis(4-carboxyphenyl)-2,4,6-trimethyl-phenyl]benzoic acid
4-[3,5-bis(4-carboxyphenyl)-2,4,6-trimethyl-phenyl]benzoic acid (CAS: 1246562-60-6) is used in the pharmaceutical industry for the synthesis of novel drugs due to its unique structure and reactivity. It also finds applications in the polymer industry as a monomer for the development of advanced polymers with specific properties. Additionally, it is utilized in the sensor and semiconductor industries for its ability to form stable complexes with metal ions and its potential for use in electronic devices.

About

English Name 4-[3,5-bis(4-carboxyphenyl)-2,4,6-trimethyl-phenyl]benzoic acid
Molecular Formula C30H24O6
Molecular Weight 480.52 g/mol
SMILES CC1C(C2C=CC(=CC=2)C(O)=O)=C(C)C(C2C=CC(=CC=2)C(O)=O)=C(C)C=1C1C=CC(=CC=1)C(O)=O
InChIKey PBPZGWJKXHZWFE-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-[3,5-bis(4-carboxyphenyl)-2,4,6-trimethyl-phenyl]benzoic acid (CAS: 1246562-60-6)?

4-[3,5-bis(4-carboxyphenyl)-2,4,6-trimethyl-phenyl]benzoic acid (CAS: 1246562-60-6) is a solid with ...

Compound Q&A

How is 4-[3,5-bis(4-carboxyphenyl)-2,4,6-trimethyl-phenyl]benzoic acid (CAS: 1246562-60-6) typically synthesized?

4-[3,5-bis(4-carboxyphenyl)-2,4,6-trimethyl-phenyl]benzoic acid (CAS: 1246562-60-6) is typically syn...

Compound Q&A

What precautions should be taken when handling 4-[3,5-bis(4-carboxyphenyl)-2,4,6-trimethyl-phenyl]benzoic acid (CAS: 1246562-60-6)?

When handling 4-[3,5-bis(4-carboxyphenyl)-2,4,6-trimethyl-phenyl]benzoic acid (CAS: 1246562-60-6), i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...