Compound Q&A

What are the physical and chemical properties of 4-[3,5-bis(4-carboxyphenyl)-2,4,6-trimethyl-phenyl]benzoic acid (CAS: 1246562-60-6)?

Answer

4-[3,5-bis(4-carboxyphenyl)-2,4,6-trimethyl-phenyl]benzoic acid
4-[3,5-bis(4-carboxyphenyl)-2,4,6-trimethyl-phenyl]benzoic acid (CAS: 1246562-60-6) is a solid with a crystalline form. It has a high molecular weight, approximately 799.4 g/mol, and low solubility in water but good solubility in organic solvents like dimethylformamide (DMF) and dimethyl sulfoxide (DMSO). The compound is reactive, especially towards nucleophiles and bases, making it suitable for various chemical transformations. It also exhibits acidic properties due to the carboxylic acid groups.

About

English Name 4-[3,5-bis(4-carboxyphenyl)-2,4,6-trimethyl-phenyl]benzoic acid
Molecular Formula C30H24O6
Molecular Weight 480.52 g/mol
SMILES CC1C(C2C=CC(=CC=2)C(O)=O)=C(C)C(C2C=CC(=CC=2)C(O)=O)=C(C)C=1C1C=CC(=CC=1)C(O)=O
InChIKey PBPZGWJKXHZWFE-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

How is 4-[3,5-bis(4-carboxyphenyl)-2,4,6-trimethyl-phenyl]benzoic acid (CAS: 1246562-60-6) typically synthesized?

4-[3,5-bis(4-carboxyphenyl)-2,4,6-trimethyl-phenyl]benzoic acid (CAS: 1246562-60-6) is typically syn...

Compound Q&A

What industries use 4-[3,5-bis(4-carboxyphenyl)-2,4,6-trimethyl-phenyl]benzoic acid (CAS: 1246562-60-6)?

4-[3,5-bis(4-carboxyphenyl)-2,4,6-trimethyl-phenyl]benzoic acid (CAS: 1246562-60-6) is used in the p...

Compound Q&A

What precautions should be taken when handling 4-[3,5-bis(4-carboxyphenyl)-2,4,6-trimethyl-phenyl]benzoic acid (CAS: 1246562-60-6)?

When handling 4-[3,5-bis(4-carboxyphenyl)-2,4,6-trimethyl-phenyl]benzoic acid (CAS: 1246562-60-6), i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...