Compound Q&A

How is 4-[3,5-bis(4-carboxyphenyl)-2,4,6-trimethyl-phenyl]benzoic acid (CAS: 1246562-60-6) typically synthesized?

Answer

4-[3,5-bis(4-carboxyphenyl)-2,4,6-trimethyl-phenyl]benzoic acid
4-[3,5-bis(4-carboxyphenyl)-2,4,6-trimethyl-phenyl]benzoic acid (CAS: 1246562-60-6) is typically synthesized via multi-step reactions. A common approach involves the condensation of 4,4'-dihydroxybiphenyl with 4-chlorobenzoic acid, followed by the introduction of the trimethyl group and the formation of the carboxylic acid groups. This process usually requires the use of catalysts such as palladium(II) acetate and triphenylphosphine, and the reaction is carried out under mild conditions to ensure high selectivity and yield.

About

English Name 4-[3,5-bis(4-carboxyphenyl)-2,4,6-trimethyl-phenyl]benzoic acid
Molecular Formula C30H24O6
Molecular Weight 480.52 g/mol
SMILES CC1C(C2C=CC(=CC=2)C(O)=O)=C(C)C(C2C=CC(=CC=2)C(O)=O)=C(C)C=1C1C=CC(=CC=1)C(O)=O
InChIKey PBPZGWJKXHZWFE-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-[3,5-bis(4-carboxyphenyl)-2,4,6-trimethyl-phenyl]benzoic acid (CAS: 1246562-60-6)?

4-[3,5-bis(4-carboxyphenyl)-2,4,6-trimethyl-phenyl]benzoic acid (CAS: 1246562-60-6) is a solid with ...

Compound Q&A

What industries use 4-[3,5-bis(4-carboxyphenyl)-2,4,6-trimethyl-phenyl]benzoic acid (CAS: 1246562-60-6)?

4-[3,5-bis(4-carboxyphenyl)-2,4,6-trimethyl-phenyl]benzoic acid (CAS: 1246562-60-6) is used in the p...

Compound Q&A

What precautions should be taken when handling 4-[3,5-bis(4-carboxyphenyl)-2,4,6-trimethyl-phenyl]benzoic acid (CAS: 1246562-60-6)?

When handling 4-[3,5-bis(4-carboxyphenyl)-2,4,6-trimethyl-phenyl]benzoic acid (CAS: 1246562-60-6), i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...