Compound Q&A

What industries use 3-(3-Fluorobenzyl)-4-[(3-fluorobenzyl)oxy]benzaldehyde (CAS: 1000370-24-0)?

Answer

3-(3-Fluorobenzyl)-4-[(3-fluorobenzyl)oxy]benzaldehyde
3-(3-Fluorobenzyl)-4-[(3-fluorobenzyl)oxy]benzaldehyde is used in the pharmaceutical industry for the synthesis of various drug molecules. It is also utilized in the production of organic semiconductors and sensors. Its reactivity towards nucleophiles and electrophiles makes it a valuable intermediate in organic synthesis.

About

English Name 3-(3-Fluorobenzyl)-4-[(3-fluorobenzyl)oxy]benzaldehyde
Molecular Formula C21H16F2O2
Molecular Weight 338.35 g/mol
SMILES O=Cc1ccc(c(c1)Cc1cccc(c1)F)OCc1cccc(c1)F
InChIKey VIFRWCOSLMTDSZ-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(3-Fluorobenzyl)-4-[(3-fluorobenzyl)oxy]benzaldehyde (CAS: 1000370-24-0)?

3-(3-Fluorobenzyl)-4-[(3-fluorobenzyl)oxy]benzaldehyde is a crystalline compound with a molecular we...

Compound Q&A

How is 3-(3-Fluorobenzyl)-4-[(3-fluorobenzyl)oxy]benzaldehyde (CAS: 1000370-24-0) typically synthesized?

3-(3-Fluorobenzyl)-4-[(3-fluorobenzyl)oxy]benzaldehyde is typically synthesized through a multi-step...

Compound Q&A

What precautions should be taken when handling 3-(3-Fluorobenzyl)-4-[(3-fluorobenzyl)oxy]benzaldehyde (CAS: 1000370-24-0)?

When handling 3-(3-Fluorobenzyl)-4-[(3-fluorobenzyl)oxy]benzaldehyde, it is essential to wear approp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...