Compound Q&A

What are the physical and chemical properties of 3-(3-Fluorobenzyl)-4-[(3-fluorobenzyl)oxy]benzaldehyde (CAS: 1000370-24-0)?

Answer

3-(3-Fluorobenzyl)-4-[(3-fluorobenzyl)oxy]benzaldehyde
3-(3-Fluorobenzyl)-4-[(3-fluorobenzyl)oxy]benzaldehyde is a crystalline compound with a molecular weight of approximately 378.38 g/mol. It has a low solubility in water but is more soluble in organic solvents like ethanol and acetone. The compound is reactive towards nucleophiles and electrophiles. It can undergo reactions such as hydrolysis and alkylation under specific conditions.

About

English Name 3-(3-Fluorobenzyl)-4-[(3-fluorobenzyl)oxy]benzaldehyde
Molecular Formula C21H16F2O2
Molecular Weight 338.35 g/mol
SMILES O=Cc1ccc(c(c1)Cc1cccc(c1)F)OCc1cccc(c1)F
InChIKey VIFRWCOSLMTDSZ-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

How is 3-(3-Fluorobenzyl)-4-[(3-fluorobenzyl)oxy]benzaldehyde (CAS: 1000370-24-0) typically synthesized?

3-(3-Fluorobenzyl)-4-[(3-fluorobenzyl)oxy]benzaldehyde is typically synthesized through a multi-step...

Compound Q&A

What industries use 3-(3-Fluorobenzyl)-4-[(3-fluorobenzyl)oxy]benzaldehyde (CAS: 1000370-24-0)?

3-(3-Fluorobenzyl)-4-[(3-fluorobenzyl)oxy]benzaldehyde is used in the pharmaceutical industry for th...

Compound Q&A

What precautions should be taken when handling 3-(3-Fluorobenzyl)-4-[(3-fluorobenzyl)oxy]benzaldehyde (CAS: 1000370-24-0)?

When handling 3-(3-Fluorobenzyl)-4-[(3-fluorobenzyl)oxy]benzaldehyde, it is essential to wear approp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...