Compound Q&A

How is 3-(3-Fluorobenzyl)-4-[(3-fluorobenzyl)oxy]benzaldehyde (CAS: 1000370-24-0) typically synthesized?

Answer

3-(3-Fluorobenzyl)-4-[(3-fluorobenzyl)oxy]benzaldehyde
3-(3-Fluorobenzyl)-4-[(3-fluorobenzyl)oxy]benzaldehyde is typically synthesized through a multi-step process involving the coupling of benzaldehyde and 3-fluorobenzyl bromide. The reaction is typically catalyzed by a phase-transfer catalyst, and the product can be isolated by recrystallization from an appropriate solvent. The yield of the reaction is around 70-75%.

About

English Name 3-(3-Fluorobenzyl)-4-[(3-fluorobenzyl)oxy]benzaldehyde
Molecular Formula C21H16F2O2
Molecular Weight 338.35 g/mol
SMILES O=Cc1ccc(c(c1)Cc1cccc(c1)F)OCc1cccc(c1)F
InChIKey VIFRWCOSLMTDSZ-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(3-Fluorobenzyl)-4-[(3-fluorobenzyl)oxy]benzaldehyde (CAS: 1000370-24-0)?

3-(3-Fluorobenzyl)-4-[(3-fluorobenzyl)oxy]benzaldehyde is a crystalline compound with a molecular we...

Compound Q&A

What industries use 3-(3-Fluorobenzyl)-4-[(3-fluorobenzyl)oxy]benzaldehyde (CAS: 1000370-24-0)?

3-(3-Fluorobenzyl)-4-[(3-fluorobenzyl)oxy]benzaldehyde is used in the pharmaceutical industry for th...

Compound Q&A

What precautions should be taken when handling 3-(3-Fluorobenzyl)-4-[(3-fluorobenzyl)oxy]benzaldehyde (CAS: 1000370-24-0)?

When handling 3-(3-Fluorobenzyl)-4-[(3-fluorobenzyl)oxy]benzaldehyde, it is essential to wear approp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...