Compound Q&A

What precautions should be taken when handling 2,4-Difluoro-3,5-dimethoxybenzoic acid (CAS: 1003709-80-5)?

Answer

2,4-Difluoro-3,5-dimethoxybenzoic acid
Proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn when handling 2,4-Difluoro-3,5-dimethoxybenzoic acid. Work should be conducted in a fume hood to minimize exposure. Spills should be cleaned up immediately with appropriate absorbent materials and disposed of according to local regulations. Always consult the safety data sheet (SDS) for detailed handling and disposal instructions.

About

English Name 2,4-Difluoro-3,5-dimethoxybenzoic acid
Molecular Formula C9H8F2O4
Molecular Weight 218.15 g/mol
SMILES COc1cc(C(=O)O)c(c(c1F)OC)F
InChIKey LLRUPRYHYIFLJS-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,4-Difluoro-3,5-dimethoxybenzoic acid (CAS: 1003709-80-5)?

2,4-Difluoro-3,5-dimethoxybenzoic acid is a solid at room temperature with a crystalline form. Its m...

Compound Q&A

How is 2,4-Difluoro-3,5-dimethoxybenzoic acid (CAS: 1003709-80-5) typically synthesized?

2,4-Difluoro-3,5-dimethoxybenzoic acid can be synthesized by the sequential reaction of 2,4-difluoro...

Compound Q&A

What industries use 2,4-Difluoro-3,5-dimethoxybenzoic acid (CAS: 1003709-80-5)?

2,4-Difluoro-3,5-dimethoxybenzoic acid is used in the pharmaceutical industry for the synthesis of c...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...