Compound Q&A

What are the physical and chemical properties of 2,4-Difluoro-3,5-dimethoxybenzoic acid (CAS: 1003709-80-5)?

Answer

2,4-Difluoro-3,5-dimethoxybenzoic acid
2,4-Difluoro-3,5-dimethoxybenzoic acid is a solid at room temperature with a crystalline form. Its molecular weight is approximately 217.07 g/mol. This compound is slightly soluble in water but more soluble in common organic solvents like ethanol and dichloromethane. It is relatively stable but can undergo slow hydrolysis in acidic or alkaline conditions. The compound shows moderate reactivity in electrophilic aromatic substitution reactions.

About

English Name 2,4-Difluoro-3,5-dimethoxybenzoic acid
Molecular Formula C9H8F2O4
Molecular Weight 218.15 g/mol
SMILES COc1cc(C(=O)O)c(c(c1F)OC)F
InChIKey LLRUPRYHYIFLJS-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

How is 2,4-Difluoro-3,5-dimethoxybenzoic acid (CAS: 1003709-80-5) typically synthesized?

2,4-Difluoro-3,5-dimethoxybenzoic acid can be synthesized by the sequential reaction of 2,4-difluoro...

Compound Q&A

What industries use 2,4-Difluoro-3,5-dimethoxybenzoic acid (CAS: 1003709-80-5)?

2,4-Difluoro-3,5-dimethoxybenzoic acid is used in the pharmaceutical industry for the synthesis of c...

Compound Q&A

What precautions should be taken when handling 2,4-Difluoro-3,5-dimethoxybenzoic acid (CAS: 1003709-80-5)?

Proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn wh...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...