Compound Q&A

How is 2,4-Difluoro-3,5-dimethoxybenzoic acid (CAS: 1003709-80-5) typically synthesized?

Answer

2,4-Difluoro-3,5-dimethoxybenzoic acid
2,4-Difluoro-3,5-dimethoxybenzoic acid can be synthesized by the sequential reaction of 2,4-difluorobenzoic acid with methanol in the presence of a suitable acid catalyst like sulfuric acid. The reaction involves methylation followed by benzoylation. The yield is around 75-85%, and the method provides good selectivity.

About

English Name 2,4-Difluoro-3,5-dimethoxybenzoic acid
Molecular Formula C9H8F2O4
Molecular Weight 218.15 g/mol
SMILES COc1cc(C(=O)O)c(c(c1F)OC)F
InChIKey LLRUPRYHYIFLJS-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,4-Difluoro-3,5-dimethoxybenzoic acid (CAS: 1003709-80-5)?

2,4-Difluoro-3,5-dimethoxybenzoic acid is a solid at room temperature with a crystalline form. Its m...

Compound Q&A

What industries use 2,4-Difluoro-3,5-dimethoxybenzoic acid (CAS: 1003709-80-5)?

2,4-Difluoro-3,5-dimethoxybenzoic acid is used in the pharmaceutical industry for the synthesis of c...

Compound Q&A

What precautions should be taken when handling 2,4-Difluoro-3,5-dimethoxybenzoic acid (CAS: 1003709-80-5)?

Proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn wh...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...