Compound Q&A

What industries use 2-Methoxy-4-nitrobenzenediazonium 5-sulfo-1-naphthalenesulfonate (CAS: 49735-71-9)?

Answer

2-Methoxy-4-nitrobenzenediazonium 5-sulfo-1-naphthalenesulfonate
2-Methoxy-4-nitrobenzenediazonium 5-sulfo-1-naphthalenesulfonate (CAS: 49735-71-9) is primarily used in the pharmaceutical, textile, and chemical analysis industries. In pharmaceuticals, it serves as an intermediate in the synthesis of various active pharmaceutical ingredients. In the textile industry, it is used in dyeing processes, providing vibrant colors. Additionally, it is employed in the chemical analysis field for reagent preparation and analytical techniques.

About

CAS No 49735-71-9
English Name 2-Methoxy-4-nitrobenzenediazonium 5-sulfo-1-naphthalenesulfonate
Molecular Formula C17H13N3O9S2
Molecular Weight 286.28 g/mol
EINECS 248-642-2
SMILES COC1=C(C=CC(=C1)[N+]([O-])=O)[N+]#N.OS(=O)(=O)C1=CC=CC2=C(C=CC=C12)S([O-])(=O)=O
InChIKey AXKAZKNOUOFMLN-UHFFFAOYSA-M
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methoxy-4-nitrobenzenediazonium 5-sulfo-1-naphthalenesulfonate (CAS: 49735-71-9)?

2-Methoxy-4-nitrobenzenediazonium 5-sulfo-1-naphthalenesulfonate (CAS: 49735-71-9) is a crystalline ...

Compound Q&A

How is 2-Methoxy-4-nitrobenzenediazonium 5-sulfo-1-naphthalenesulfonate (CAS: 49735-71-9) typically synthesized?

2-Methoxy-4-nitrobenzenediazonium 5-sulfo-1-naphthalenesulfonate can be synthesized through diazotiz...

Compound Q&A

What precautions should be taken when handling 2-Methoxy-4-nitrobenzenediazonium 5-sulfo-1-naphthalenesulfonate (CAS: 49735-71-9)?

When handling 2-Methoxy-4-nitrobenzenediazonium 5-sulfo-1-naphthalenesulfonate (CAS: 49735-71-9), it...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...