Compound Q&A

What are the physical and chemical properties of 2-Methoxy-4-nitrobenzenediazonium 5-sulfo-1-naphthalenesulfonate (CAS: 49735-71-9)?

Answer

2-Methoxy-4-nitrobenzenediazonium 5-sulfo-1-naphthalenesulfonate
2-Methoxy-4-nitrobenzenediazonium 5-sulfo-1-naphthalenesulfonate (CAS: 49735-71-9) is a crystalline compound with a molecular weight of approximately 455.11 g/mol. It is moderately soluble in water and organic solvents, demonstrating good solubility in acetic acid. This compound shows moderate reactivity in acidic conditions and is used in various chemical processes requiring diazonium salts. Its properties make it suitable for applications in dyeing, chemical analysis, and other industrial processes.

About

CAS No 49735-71-9
English Name 2-Methoxy-4-nitrobenzenediazonium 5-sulfo-1-naphthalenesulfonate
Molecular Formula C17H13N3O9S2
Molecular Weight 286.28 g/mol
EINECS 248-642-2
SMILES COC1=C(C=CC(=C1)[N+]([O-])=O)[N+]#N.OS(=O)(=O)C1=CC=CC2=C(C=CC=C12)S([O-])(=O)=O
InChIKey AXKAZKNOUOFMLN-UHFFFAOYSA-M
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

How is 2-Methoxy-4-nitrobenzenediazonium 5-sulfo-1-naphthalenesulfonate (CAS: 49735-71-9) typically synthesized?

2-Methoxy-4-nitrobenzenediazonium 5-sulfo-1-naphthalenesulfonate can be synthesized through diazotiz...

Compound Q&A

What industries use 2-Methoxy-4-nitrobenzenediazonium 5-sulfo-1-naphthalenesulfonate (CAS: 49735-71-9)?

2-Methoxy-4-nitrobenzenediazonium 5-sulfo-1-naphthalenesulfonate (CAS: 49735-71-9) is primarily used...

Compound Q&A

What precautions should be taken when handling 2-Methoxy-4-nitrobenzenediazonium 5-sulfo-1-naphthalenesulfonate (CAS: 49735-71-9)?

When handling 2-Methoxy-4-nitrobenzenediazonium 5-sulfo-1-naphthalenesulfonate (CAS: 49735-71-9), it...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...