Compound Q&A

How is 2-Methoxy-4-nitrobenzenediazonium 5-sulfo-1-naphthalenesulfonate (CAS: 49735-71-9) typically synthesized?

Answer

2-Methoxy-4-nitrobenzenediazonium 5-sulfo-1-naphthalenesulfonate
2-Methoxy-4-nitrobenzenediazonium 5-sulfo-1-naphthalenesulfonate can be synthesized through diazotization of 2-methoxy-4-nitrobenzene in the presence of a suitable sulfonating agent, such as sodium nitrite and sodium 5-sulfo-1-naphthalenesulfonate. The reaction is typically carried out in an acidic medium, yielding a product with high purity and selectivity. This process allows for controlled synthesis with good yield and is widely used in the preparation of diazonium salts for various applications.

About

CAS No 49735-71-9
English Name 2-Methoxy-4-nitrobenzenediazonium 5-sulfo-1-naphthalenesulfonate
Molecular Formula C17H13N3O9S2
Molecular Weight 286.28 g/mol
EINECS 248-642-2
SMILES COC1=C(C=CC(=C1)[N+]([O-])=O)[N+]#N.OS(=O)(=O)C1=CC=CC2=C(C=CC=C12)S([O-])(=O)=O
InChIKey AXKAZKNOUOFMLN-UHFFFAOYSA-M
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methoxy-4-nitrobenzenediazonium 5-sulfo-1-naphthalenesulfonate (CAS: 49735-71-9)?

2-Methoxy-4-nitrobenzenediazonium 5-sulfo-1-naphthalenesulfonate (CAS: 49735-71-9) is a crystalline ...

Compound Q&A

What industries use 2-Methoxy-4-nitrobenzenediazonium 5-sulfo-1-naphthalenesulfonate (CAS: 49735-71-9)?

2-Methoxy-4-nitrobenzenediazonium 5-sulfo-1-naphthalenesulfonate (CAS: 49735-71-9) is primarily used...

Compound Q&A

What precautions should be taken when handling 2-Methoxy-4-nitrobenzenediazonium 5-sulfo-1-naphthalenesulfonate (CAS: 49735-71-9)?

When handling 2-Methoxy-4-nitrobenzenediazonium 5-sulfo-1-naphthalenesulfonate (CAS: 49735-71-9), it...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...