Compound Q&A

What precautions should be taken when handling [4-(Cyclopropylcarbamoyl)phenyl]boronic acid (CAS: 860173-33-7)?

Answer

[4-(Cyclopropylcarbamoyl)phenyl]boronic acid
When handling [4-(Cyclopropylcarbamoyl)phenyl]boronic acid (CAS: 860173-33-7), it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or fume hood to minimize exposure. Spills should be cleaned up immediately with appropriate absorbent materials. Refer to the Safety Data Sheet (SDS) for detailed handling instructions and emergency procedures.

About

English Name [4-(Cyclopropylcarbamoyl)phenyl]boronic acid
Molecular Formula C10H12BNO3
Molecular Weight 205.02 g/mol
SMILES OB(c1ccc(cc1)C(=O)NC1CC1)O
InChIKey WCRPDYXXIVYAAJ-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of [4-(Cyclopropylcarbamoyl)phenyl]boronic acid (CAS: 860173-33-7)?

[4-(Cyclopropylcarbamoyl)phenyl]boronic acid (CAS: 860173-33-7) is a solid with a crystalline form. ...

Compound Q&A

How is [4-(Cyclopropylcarbamoyl)phenyl]boronic acid (CAS: 860173-33-7) typically synthesized?

[4-(Cyclopropylcarbamoyl)phenyl]boronic acid (CAS: 860173-33-7) can be synthesized through a multist...

Compound Q&A

What industries use [4-(Cyclopropylcarbamoyl)phenyl]boronic acid (CAS: 860173-33-7)?

[4-(Cyclopropylcarbamoyl)phenyl]boronic acid (CAS: 860173-33-7) is primarily used in pharmaceuticals...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...