Compound Q&A

How is [4-(Cyclopropylcarbamoyl)phenyl]boronic acid (CAS: 860173-33-7) typically synthesized?

Answer

[4-(Cyclopropylcarbamoyl)phenyl]boronic acid
[4-(Cyclopropylcarbamoyl)phenyl]boronic acid (CAS: 860173-33-7) can be synthesized through a multistep process involving the preparation of 4-(cyclopropylcarbamoyl)phenol and subsequent coupling with boronic acid derivatives. This synthesis typically requires organic solvents, mild base conditions, and appropriate catalysts to achieve good yield and selectivity.

About

English Name [4-(Cyclopropylcarbamoyl)phenyl]boronic acid
Molecular Formula C10H12BNO3
Molecular Weight 205.02 g/mol
SMILES OB(c1ccc(cc1)C(=O)NC1CC1)O
InChIKey WCRPDYXXIVYAAJ-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of [4-(Cyclopropylcarbamoyl)phenyl]boronic acid (CAS: 860173-33-7)?

[4-(Cyclopropylcarbamoyl)phenyl]boronic acid (CAS: 860173-33-7) is a solid with a crystalline form. ...

Compound Q&A

What industries use [4-(Cyclopropylcarbamoyl)phenyl]boronic acid (CAS: 860173-33-7)?

[4-(Cyclopropylcarbamoyl)phenyl]boronic acid (CAS: 860173-33-7) is primarily used in pharmaceuticals...

Compound Q&A

What precautions should be taken when handling [4-(Cyclopropylcarbamoyl)phenyl]boronic acid (CAS: 860173-33-7)?

When handling [4-(Cyclopropylcarbamoyl)phenyl]boronic acid (CAS: 860173-33-7), it is essential to we...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...