Compound Q&A

What industries use [4-(Cyclopropylcarbamoyl)phenyl]boronic acid (CAS: 860173-33-7)?

Answer

[4-(Cyclopropylcarbamoyl)phenyl]boronic acid
[4-(Cyclopropylcarbamoyl)phenyl]boronic acid (CAS: 860173-33-7) is primarily used in pharmaceuticals for the synthesis of drug intermediates. It also finds applications in the polymer industry for the development of new materials and in sensors for detection of specific chemical species. Additionally, it is utilized in semiconductor manufacturing for etching processes.

About

English Name [4-(Cyclopropylcarbamoyl)phenyl]boronic acid
Molecular Formula C10H12BNO3
Molecular Weight 205.02 g/mol
SMILES OB(c1ccc(cc1)C(=O)NC1CC1)O
InChIKey WCRPDYXXIVYAAJ-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of [4-(Cyclopropylcarbamoyl)phenyl]boronic acid (CAS: 860173-33-7)?

[4-(Cyclopropylcarbamoyl)phenyl]boronic acid (CAS: 860173-33-7) is a solid with a crystalline form. ...

Compound Q&A

How is [4-(Cyclopropylcarbamoyl)phenyl]boronic acid (CAS: 860173-33-7) typically synthesized?

[4-(Cyclopropylcarbamoyl)phenyl]boronic acid (CAS: 860173-33-7) can be synthesized through a multist...

Compound Q&A

What precautions should be taken when handling [4-(Cyclopropylcarbamoyl)phenyl]boronic acid (CAS: 860173-33-7)?

When handling [4-(Cyclopropylcarbamoyl)phenyl]boronic acid (CAS: 860173-33-7), it is essential to we...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...