Compound Q&A

What precautions should be taken when handling 8-Anilino-8-oxooctanoic acid (CAS: 149648-52-2)?

Answer

8-Anilino-8-oxooctanoic acid
When handling 8-Anilino-8-oxooctanoic acid (CAS: 149648-52-2), it is important to wear appropriate personal protective equipment (PPE), including gloves, goggles, and a lab coat. Store the compound in a well-ventilated area and use a fume hood during operations. In case of a spill, immediately evacuate the area and follow the emergency procedures outlined in the safety data sheet (SDS).

About

English Name 8-Anilino-8-oxooctanoic acid
Molecular Formula C14H19NO3
Molecular Weight 249.31 g/mol
SMILES C1=CC=C(C=C1)NC(=O)CCCCCCC(=O)O
InChIKey PAXDAFSGJPGLGR-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 8-Anilino-8-oxooctanoic acid (CAS: 149648-52-2)?

8-Anilino-8-oxooctanoic acid (CAS: 149648-52-2) is a crystalline solid with a molecular weight of ap...

Compound Q&A

How is 8-Anilino-8-oxooctanoic acid (CAS: 149648-52-2) typically synthesized?

8-Anilino-8-oxooctanoic acid is typically synthesized by the condensation of anilino-8-oxooctanoic a...

Compound Q&A

What industries use 8-Anilino-8-oxooctanoic acid (CAS: 149648-52-2)?

8-Anilino-8-oxooctanoic acid (CAS: 149648-52-2) is used in various industries. It serves as a key in...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...