Compound Q&A

What industries use 8-Anilino-8-oxooctanoic acid (CAS: 149648-52-2)?

Answer

8-Anilino-8-oxooctanoic acid
8-Anilino-8-oxooctanoic acid (CAS: 149648-52-2) is used in various industries. It serves as a key intermediate in the synthesis of pharmaceuticals, particularly in the development of antiviral and antifungal drugs. It is also utilized in the production of sensors for detecting nitrogen oxides and in the manufacturing of certain polymers and semiconductors.

About

English Name 8-Anilino-8-oxooctanoic acid
Molecular Formula C14H19NO3
Molecular Weight 249.31 g/mol
SMILES C1=CC=C(C=C1)NC(=O)CCCCCCC(=O)O
InChIKey PAXDAFSGJPGLGR-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 8-Anilino-8-oxooctanoic acid (CAS: 149648-52-2)?

8-Anilino-8-oxooctanoic acid (CAS: 149648-52-2) is a crystalline solid with a molecular weight of ap...

Compound Q&A

How is 8-Anilino-8-oxooctanoic acid (CAS: 149648-52-2) typically synthesized?

8-Anilino-8-oxooctanoic acid is typically synthesized by the condensation of anilino-8-oxooctanoic a...

Compound Q&A

What precautions should be taken when handling 8-Anilino-8-oxooctanoic acid (CAS: 149648-52-2)?

When handling 8-Anilino-8-oxooctanoic acid (CAS: 149648-52-2), it is important to wear appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...