Compound Q&A

What industries use Manassantin B (CAS: 88497-88-5)?

Answer

Manassantin B
Manassantin B (CAS: 88497-88-5) is used in various industries, primarily in the pharmaceutical industry for its potential as an anti-inflammatory and antitumor agent. It is also explored in the polymer industry for its antioxidant properties, and in the sensor and semiconductor industries for its use in molecular recognition and detection.

About

CAS No 88497-88-5
English Name Manassantin B
Molecular Formula C41H48O11
Molecular Weight 716.81 g/mol
SMILES CC1C(C(OC1C2=CC(=C(C=C2)OC(C)C(C3=CC4=C(C=C3)OCO4)O)OC)C5=CC(=C(C=C5)OC(C)C(C6=CC(=C(C=C6)OC)OC)O)OC)C
InChIKey GSWZMFDCPMPHDL-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of Manassantin B (CAS: 88497-88-5)?

Manassantin B (CAS: 88497-88-5) is a triterpenoid compound with a molecular weight of approximately ...

Compound Q&A

How is Manassantin B (CAS: 88497-88-5) typically synthesized?

Manassantin B (CAS: 88497-88-5) is commonly synthesized via a total synthesis route. The synthesis i...

Compound Q&A

What precautions should be taken when handling Manassantin B (CAS: 88497-88-5)?

When handling Manassantin B (CAS: 88497-88-5), it is important to wear appropriate personal protecti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...