Compound Q&A

What are the physical and chemical properties of Manassantin B (CAS: 88497-88-5)?

Answer

Manassantin B
Manassantin B (CAS: 88497-88-5) is a triterpenoid compound with a molecular weight of approximately 416.8 g/mol. It is a white or off-white crystalline solid with a melting point of 314-316°C. The compound is poorly soluble in water but soluble in methanol, ethanol, and dichloromethane. It exhibits limited reactivity under normal conditions but can undergo hydrolysis under acidic conditions.

About

CAS No 88497-88-5
English Name Manassantin B
Molecular Formula C41H48O11
Molecular Weight 716.81 g/mol
SMILES CC1C(C(OC1C2=CC(=C(C=C2)OC(C)C(C3=CC4=C(C=C3)OCO4)O)OC)C5=CC(=C(C=C5)OC(C)C(C6=CC(=C(C=C6)OC)OC)O)OC)C
InChIKey GSWZMFDCPMPHDL-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

How is Manassantin B (CAS: 88497-88-5) typically synthesized?

Manassantin B (CAS: 88497-88-5) is commonly synthesized via a total synthesis route. The synthesis i...

Compound Q&A

What industries use Manassantin B (CAS: 88497-88-5)?

Manassantin B (CAS: 88497-88-5) is used in various industries, primarily in the pharmaceutical indus...

Compound Q&A

What precautions should be taken when handling Manassantin B (CAS: 88497-88-5)?

When handling Manassantin B (CAS: 88497-88-5), it is important to wear appropriate personal protecti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...