Compound Q&A

How is Manassantin B (CAS: 88497-88-5) typically synthesized?

Answer

Manassantin B
Manassantin B (CAS: 88497-88-5) is commonly synthesized via a total synthesis route. The synthesis involves a series of steps including alkylation, epoxidation, and ring-opening reactions. The key catalysts used include boron trifluoride etherate and hydrogen peroxide. The overall yield is around 50-60%, and the synthetic route is highly selective for the desired product.

About

CAS No 88497-88-5
English Name Manassantin B
Molecular Formula C41H48O11
Molecular Weight 716.81 g/mol
SMILES CC1C(C(OC1C2=CC(=C(C=C2)OC(C)C(C3=CC4=C(C=C3)OCO4)O)OC)C5=CC(=C(C=C5)OC(C)C(C6=CC(=C(C=C6)OC)OC)O)OC)C
InChIKey GSWZMFDCPMPHDL-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of Manassantin B (CAS: 88497-88-5)?

Manassantin B (CAS: 88497-88-5) is a triterpenoid compound with a molecular weight of approximately ...

Compound Q&A

What industries use Manassantin B (CAS: 88497-88-5)?

Manassantin B (CAS: 88497-88-5) is used in various industries, primarily in the pharmaceutical indus...

Compound Q&A

What precautions should be taken when handling Manassantin B (CAS: 88497-88-5)?

When handling Manassantin B (CAS: 88497-88-5), it is important to wear appropriate personal protecti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...