Compound Q&A

What industries use Ethyl 4-acetamido-3-hydroxybenzoate (CAS: 1346604-18-9)?

Answer

Ethyl 4-acetamido-3-hydroxybenzoate
Ethyl 4-acetamido-3-hydroxybenzoate finds applications in the pharmaceutical industry, where it serves as an intermediate in the synthesis of various drugs. It is also used in the production of organic pigments and dyes due to its color properties. Limited data suggests its use in the sensor industry for specific chemical detection applications.

About

English Name Ethyl 4-acetamido-3-hydroxybenzoate
Molecular Formula C11H13NO4
Molecular Weight 223.23 g/mol
SMILES CCOC(=O)c1ccc(c(c1)O)NC(=O)C
InChIKey UURVEOMRNSPVTI-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 4-acetamido-3-hydroxybenzoate (CAS: 1346604-18-9)?

Ethyl 4-acetamido-3-hydroxybenzoate is a crystalline solid with a molecular weight of approximately ...

Compound Q&A

How is Ethyl 4-acetamido-3-hydroxybenzoate (CAS: 1346604-18-9) typically synthesized?

Ethyl 4-acetamido-3-hydroxybenzoate is synthesized by the acetylation of 4-amino-3-hydroxybenzoic ac...

Compound Q&A

What precautions should be taken when handling Ethyl 4-acetamido-3-hydroxybenzoate (CAS: 1346604-18-9)?

When handling Ethyl 4-acetamido-3-hydroxybenzoate, it is essential to wear appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...