Compound Q&A

How is Ethyl 4-acetamido-3-hydroxybenzoate (CAS: 1346604-18-9) typically synthesized?

Answer

Ethyl 4-acetamido-3-hydroxybenzoate
Ethyl 4-acetamido-3-hydroxybenzoate is synthesized by the acetylation of 4-amino-3-hydroxybenzoic acid with ethyl acetoacetate in the presence of an acid catalyst such as sulfuric acid. The reaction is typically carried out at elevated temperatures, and the product is purified through recrystallization from an appropriate solvent.

About

English Name Ethyl 4-acetamido-3-hydroxybenzoate
Molecular Formula C11H13NO4
Molecular Weight 223.23 g/mol
SMILES CCOC(=O)c1ccc(c(c1)O)NC(=O)C
InChIKey UURVEOMRNSPVTI-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 4-acetamido-3-hydroxybenzoate (CAS: 1346604-18-9)?

Ethyl 4-acetamido-3-hydroxybenzoate is a crystalline solid with a molecular weight of approximately ...

Compound Q&A

What industries use Ethyl 4-acetamido-3-hydroxybenzoate (CAS: 1346604-18-9)?

Ethyl 4-acetamido-3-hydroxybenzoate finds applications in the pharmaceutical industry, where it serv...

Compound Q&A

What precautions should be taken when handling Ethyl 4-acetamido-3-hydroxybenzoate (CAS: 1346604-18-9)?

When handling Ethyl 4-acetamido-3-hydroxybenzoate, it is essential to wear appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...