Compound Q&A

What industries use 2-(2,6-Dioxo-3-piperidinyl)-5,6-difluoro-1H-isoindole-1,3(2H)-dione (CAS: 1496997-41-1)?

Answer

2-(2,6-Dioxo-3-piperidinyl)-5,6-difluoro-1H-isoindole-1,3(2H)-dione
This compound is primarily used in the pharmaceutical industry for the synthesis of various drug candidates. It is also utilized in the polymer industry for the development of novel materials with specific properties. Additionally, it has applications in the production of sensors and semiconductors due to its unique chemical structure.

About

English Name 2-(2,6-Dioxo-3-piperidinyl)-5,6-difluoro-1H-isoindole-1,3(2H)-dione
Molecular Formula C13H8F2N2O4
Molecular Weight 294.21 g/mol
SMILES Fc1cc2C(=O)N(C3CCC(=O)NC3=O)C(=O)c2cc1F
InChIKey AGHXYRKTAZEQQW-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(2,6-Dioxo-3-piperidinyl)-5,6-difluoro-1H-isoindole-1,3(2H)-dione (CAS: 1496997-41-1)?

2-(2,6-Dioxo-3-piperidinyl)-5,6-difluoro-1H-isoindole-1,3(2H)-dione is a crystalline solid with a mo...

Compound Q&A

How is 2-(2,6-Dioxo-3-piperidinyl)-5,6-difluoro-1H-isoindole-1,3(2H)-dione (CAS: 1496997-41-1) typically synthesized?

2-(2,6-Dioxo-3-piperidinyl)-5,6-difluoro-1H-isoindole-1,3(2H)-dione is synthesized via the amidation...

Compound Q&A

What precautions should be taken when handling 2-(2,6-Dioxo-3-piperidinyl)-5,6-difluoro-1H-isoindole-1,3(2H)-dione (CAS: 1496997-41-1)?

Proper personal protective equipment (PPE) including gloves, goggles, and a lab coat should be worn ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...